BDBM796931 US12581252, Example I-1437
SMILES N#Cc1cc2nccn2cc1-c1cc(NC(=O)c2cc(F)cc(C(F)(F)F)c2)c2c(c1)C(=O)NC2c1cc(F)ccc1Cl
InChI Key
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 1 hit for monomerid = 796931
TargetPhosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit alpha isoform(Human)
Relay Therapeutics
US Patent
Relay Therapeutics
US Patent
Affinity DataIC50: 100nMAssay Description:NMDA receptors are ion channels that are highly permeable to Ca2+ ions, rendering it possible to monitor NMDA receptor function using cell-based calc...More data for this Ligand-Target Pair
