BDBM160492 BDBM160493::US10093663, Example 32-1::US9682968, Example-31
SMILES CNC1CCN(Cc2c(C)cc(C)c3[nH]ccc23)C(C1)c1ccccc1
InChI Key
Data 6 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 6 hits for monomerid = 160492
Affinity DataIC50: 6.80nMAssay Description:CVF-Bb complex prepared from purified cobra venom factor (1 μM), recombinant human complement factor B (expressed in drosophila cells and purifi...More data for this Ligand-Target Pair
Affinity DataIC50: 36nMAssay Description:CVF-Bb complex prepared from purified cobra venom factor (1 μM), recombinant human complement factor B (expressed in drosophila cells and purifi...More data for this Ligand-Target Pair
Affinity DataIC50: 3.60E+4nMAssay Description:Inhibition of human serine protease factor B by TR-FRET based competition binding assayMore data for this Ligand-Target Pair
Affinity DataIC50: 3.60E+4nMpH: 7.4 T: 2°CAssay Description:CVF-Bb complex prepared from purified cobra venom factor (1 μM), recombinant human complement factor B (expressed in drosophila cells and purifi...More data for this Ligand-Target Pair
Affinity DataIC50: 3.60E+4nMAssay Description:Inhibition of human serine protease factor B by TR-FRET based competition binding assayMore data for this Ligand-Target Pair
Affinity DataIC50: 6.80E+3nMpH: 7.4 T: 2°CAssay Description:CVF-Bb complex prepared from purified cobra venom factor (1 μM), recombinant human complement factor B (expressed in drosophila cells and purifi...More data for this Ligand-Target Pair