BDBM19237 2-[4-(4-{[benzyl(3-methanesulfonamido-2-methylphenyl)amino]methyl}phenoxy)phenoxy]acetic acid::GR sulfonamide modulator, 14

SMILES Cc1c(NS(C)(=O)=O)cccc1N(Cc1ccccc1)Cc1ccc(Oc2ccc(OCC(O)=O)cc2)cc1

InChI Key InChIKey=AJAOWKDQDBTLKO-UHFFFAOYSA-N

Data  5 IC50  1 EC50

  Tab Delimited (TSV)   2D SDfile   Computed 3D by Vconf -m prep SDfile
Find this compound or compounds like it in BindingDB:
   Substructure
Similarity at least:  must be >=0.5
Exact match

Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB

Found 5 hits for monomerid = 19237   

TargetGlucocorticoid receptor(Homo sapiens (Human))
Abbott Laboratories

LigandPNGBDBM19237(2-[4-(4-{[benzyl(3-methanesulfonamido-2-methylphen...)
Affinity DataIC50:  5.40nM EC50:  255nMpH: 8.0 T: 2°CAssay Description:For compounds able to displace the 3(H)-dexamethasone from the receptor an IC50 value (the concentration required to inhibit 50% of the binding of 3(...More data for this Ligand-Target Pair
In DepthDetails ArticlePubMed
TargetGlucocorticoid receptor(RAT)
Abbott Laboratories

LigandPNGBDBM19237(2-[4-(4-{[benzyl(3-methanesulfonamido-2-methylphen...)
Affinity DataIC50:  2.10nMpH: 8.0 T: 2°CAssay Description:For compounds able to displace the radiolabeled ligand (competitor) from the receptor an IC50 value (the concentration required to inhibit 50% of the...More data for this Ligand-Target Pair
In DepthDetails ArticlePubMed
TargetMineralocorticoid receptor(Homo sapiens (Human))
Abbott Laboratories

LigandPNGBDBM19237(2-[4-(4-{[benzyl(3-methanesulfonamido-2-methylphen...)
Affinity DataIC50:  690nMpH: 8.0 T: 2°CAssay Description:For compounds able to displace the radiolabeled ligand (competitor) from the receptor an IC50 value (the concentration required to inhibit 50% of the...More data for this Ligand-Target Pair
In DepthDetails ArticlePubMed
TargetAndrogen receptor(Homo sapiens (Human))
Abbott Laboratories

LigandPNGBDBM19237(2-[4-(4-{[benzyl(3-methanesulfonamido-2-methylphen...)
Affinity DataIC50:  1.17E+4nMpH: 8.0 T: 2°CAssay Description:For compounds able to displace the radiolabeled ligand (competitor) from the receptor an IC50 value (the concentration required to inhibit 50% of the...More data for this Ligand-Target Pair
In DepthDetails ArticlePubMed
TargetProgesterone receptor(Homo sapiens (Human))
Abbott Laboratories

LigandPNGBDBM19237(2-[4-(4-{[benzyl(3-methanesulfonamido-2-methylphen...)
Affinity DataIC50:  1.70E+3nMpH: 8.0 T: 2°CAssay Description:For compounds able to displace the radiolabeled ligand (competitor) from the receptor an IC50 value (the concentration required to inhibit 50% of the...More data for this Ligand-Target Pair
In DepthDetails ArticlePubMed