BDBM362032 (S)-3-(2-(1-((2-amino-5-cyano-6-(difluoromethyl)pyrimidin-4-yl)amino)ethyl)-5-chloro-4-oxoquinazolin-3(4H)-yl)benzamide::US10221197, Compound 25::US10221197, Compound 26
SMILES C[C@H](Nc1nc(N)nc(C(F)F)c1C#N)c1nc2c(Cl)cc(F)cc2c(=O)n1-c1cccc(c1)C(N)=O
InChI Key InChIKey=HVIXLGUBYXXBAI-VIFPVBQESA-N
Data 6 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 6 hits for monomerid = 362032
Affinity DataIC50: 2.40E+4nMAssay Description:TR-FRET monitored the formation of 3,4,5-inositol triphosphate molecule that competed with fluorescently labeled PIP3 for binding to the GRP-1 plecks...More data for this Ligand-Target Pair
TargetPhosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit delta isoform(Human)
Gilead Sciences
US Patent
Gilead Sciences
US Patent
TargetPhosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform(Human)
Gilead Sciences
US Patent
Gilead Sciences
US Patent
Affinity DataIC50: 3.13E+5nMAssay Description:TR-FRET monitored the formation of 3,4,5-inositol triphosphate molecule that competed with fluorescently labeled PIP3 for binding to the GRP-1 plecks...More data for this Ligand-Target Pair
TargetPhosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit delta isoform(Human)
Gilead Sciences
US Patent
Gilead Sciences
US Patent
TargetPhosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform(Human)
Gilead Sciences
US Patent
Gilead Sciences
US Patent