Details for Substrate BDBM11526 without Explicit Binding Affinity Data | |
| Prolyl endopeptidase FAP |
| Dipeptidyl peptidase 2 |
| Dipeptidyl peptidase 8 |
| Dipeptidyl peptidase 4 |
Synonyms: | 1-(2-aminoacetyl)-N-(4-nitrophenyl)pyrrolidine-2-carboxamide | Gly-Pro-p-nitroaniline | Gly-Pro-pNA |
Type: | Small organic molecule |
Emp. Form.: | C13H16N4O4 |
Mol. Mass.: | 292.2905 g/mol |
SMILES: | NCC(=O)N1CCCC1C(=O)Nc1ccc(cc1)[N+]([O-])=O |
Structure: |
Courtesy of Chemaxon Inc. - Use mouse to adjust image. - Double-click and use "Edit" menu to generate mol-file. |