Details for Substrate BDBM12679 without Explicit Binding Affinity Data | |
| Plasminogen |
| Coagulation factor IX |
| Coagulation factor VII |
| Serine protease 1 |
| Prothrombin |
| Tryptase beta-2 |
Synonyms: | BDBM13790 | BDBM14298 | Chromogenic Substrate |
Type: | Small organic molecule |
Emp. Form.: | C26H34N6O7S |
Mol. Mass.: | 574.649 g/mol |
SMILES: | Cc1ccc(cc1)S(=O)(=O)NCC(=O)N1CCCC1C(=O)NC(CCCCN)C(=O)Nc1ccc(cc1)[N+]([O-])=O |
Structure: |
Courtesy of Chemaxon Inc. - Use mouse to adjust image. - Double-click and use "Edit" menu to generate mol-file. |