Details for Substrate BDBM13066 without Explicit Binding Affinity Data | |
| Cytochrome P450 2C9 |
| UDP-glucuronosyltransferase 2B7 |
| UDP-glucuronosyltransferase 2B10 |
Synonyms: | 2-{2-[(2,6-dichlorophenyl)amino]phenyl}acetic acid | CHEMBL139 | Diclofenac | US11337935, Compound Diclofenac | US11478464, Compound Diclofenac | US11786535, Compound Diclofenac | {2-[(2,6-dichlorophenyl)amino]phenyl}acetic acid |
Type: | Small organic molecule |
Emp. Form.: | C14H11Cl2NO2 |
Mol. Mass.: | 296.149 g/mol |
SMILES: | OC(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl |
Structure: |
Courtesy of Chemaxon Inc. - Use mouse to adjust image. - Double-click and use "Edit" menu to generate mol-file. |