Details for Substrate BDBM22319 without Explicit Binding Affinity Data | |
| Prostaglandin G/H synthase 1 |
| Polyunsaturated fatty acid 5-lipoxygenase |
| Prostaglandin G/H synthase 2 |
Synonyms: | (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoic acid | Arachidonic acid | Arachidonic acid (AA) | CHEMBL15594 | [1-14C]Arachidonic acid |
Type: | Unsaturated fatty acid |
Emp. Form.: | C20H32O2 |
Mol. Mass.: | 304.4669 g/mol |
SMILES: | CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC(O)=O |
Structure: |
Courtesy of Chemaxon Inc. - Use mouse to adjust image. - Double-click and use "Edit" menu to generate mol-file. |