BDBM16301 3-[4-(4-chlorophenyl)cyclohexyl]naphthalene-1,2,4-triol::Atovaquone::Mepron
SMILES Clc1ccc(cc1)C1CCC(CC1)C1C(=O)C(=O)c2ccccc2C1=O
InChI Key InChIKey=UYFLKEIEOREOFC-UHFFFAOYSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 16301
Affinity DataIC50: 904nMpH: 8.0 T: 30°CAssay Description:To determine the inhibitory potency of the drugs, the initial velocity of the DHODR-catalyzed reaction at saturating concentrations of DHO (1 mM) and...More data for this Ligand-Target Pair
Affinity DataIC50: 698nMpH: 8.0 T: 30°CAssay Description:To determine the inhibitory potency of the drugs, the initial velocity of the DHODR-catalyzed reaction at saturating concentrations of DHO (1 mM) and...More data for this Ligand-Target Pair