BDBM773690 US20250296939, Example 81
SMILES CC[C@H]1Cc2ccc(O)nc2CN(Cc2cc([C@H](CC(=O)O)c3cnc4c(nnn4C)c3C)cc3ccsc23)C1
InChI Key
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 1 hit for monomerid = 773690
TargetKelch-like ECH-associated protein 1/NAD(P)H dehydrogenase [quinone] 1/Nuclear factor erythroid 2-related factor 2(Human)
Kyoto Pharmaceutical Industries
US Patent
Kyoto Pharmaceutical Industries
US Patent
Affinity DataIC50: 20nMAssay Description:Compounds were tested in biochemical protein-protein interaction assays to determine if they can specifically block the interaction between the extra...More data for this Ligand-Target Pair
