BDBM18873 (2R)-2-(1-{3,5-dibromo-4-[4-hydroxy-3-(propan-2-yl)phenoxy]phenyl}acetamido)propanoic acid::N-acylated-alpha-amino acid derivative, 3c

SMILES CC(C)c1cc(Oc2c(Br)cc(CC(=O)N[C@H](C)C(O)=O)cc2Br)ccc1O

InChI Key InChIKey=GJHNXKYHUKQSDL-LLVKDONJSA-N

Data  2 IC50  2 EC50

  Tab Delimited (TSV)   2D SDfile   Computed 3D by Vconf -m prep SDfile
Find this compound or compounds like it in BindingDB:
   Substructure
Similarity at least:  must be >=0.5
Exact match

Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB

Found 2 hits for monomerid = 18873   

TargetThyroid hormone receptor beta(Homo sapiens (Human))
Karo Bio

LigandPNGBDBM18873((2R)-2-(1-{3,5-dibromo-4-[4-hydroxy-3-(propan-2-yl...)
Affinity DataIC50:  5.90nM EC50:  7.60nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRbeta. EC50 is the concentration of compound required to r...More data for this Ligand-Target Pair
In DepthDetails ArticlePubMed
TargetThyroid hormone receptor alpha(Homo sapiens (Human))
Karo Bio

LigandPNGBDBM18873((2R)-2-(1-{3,5-dibromo-4-[4-hydroxy-3-(propan-2-yl...)
Affinity DataIC50:  83nM EC50:  15nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRalpha. EC50 is the concentration of compound required to ...More data for this Ligand-Target Pair
In DepthDetails ArticlePubMed