BDBM18876 (2S)-2-(1-{3,5-dibromo-4-[4-hydroxy-3-(propan-2-yl)phenoxy]phenyl}acetamido)-2-phenylacetic acid::N-acylated-alpha-amino acid derivative, 3f
SMILES CC(C)c1cc(Oc2c(Br)cc(CC(=O)N[C@H](C(O)=O)c3ccccc3)cc2Br)ccc1O
InChI Key InChIKey=RTHIDWPAXBKXPV-QHCPKHFHSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 18876
Affinity DataIC50: 0.780nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRbeta. EC50 is the concentration of compound required to r...More data for this Ligand-Target Pair
Affinity DataIC50: 7.5nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRalpha. EC50 is the concentration of compound required to ...More data for this Ligand-Target Pair