BDBM18880 (2S)-2-(1-{3,5-dibromo-4-[3-fluoro-4-hydroxy-5-(propan-2-yl)phenoxy]phenyl}acetamido)-3-methylbutanoic acid::N-acylated-alpha-amino acid derivative, 7
SMILES CC(C)[C@H](NC(=O)Cc1cc(Br)c(Oc2cc(F)c(O)c(c2)C(C)C)c(Br)c1)C(O)=O
InChI Key InChIKey=MBDWXBYHNXYRAW-IBGZPJMESA-N
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 18880
Affinity DataIC50: 12nM EC50: 11nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRbeta. EC50 is the concentration of compound required to r...More data for this Ligand-Target Pair
Affinity DataIC50: 88nM EC50: 17nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRalpha. EC50 is the concentration of compound required to ...More data for this Ligand-Target Pair