BDBM260656 US9533985, 44
SMILES CCNC(=O)c1ccc(cc1)S(=O)(=O)Nc1cc(F)c(C(=O)N[C@@H](Cc2ccc(cc2)-n2c(=O)ccn(C)c2=O)C(O)=O)c(F)c1
InChI Key InChIKey=XMUQMOVIUQVKPD-DEOSSOPVSA-N
Data 3 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 3 hits for monomerid = 260656
TargetIntegrin alpha-4/Integrin beta-7/Mucosal addressin cell adhesion molecule 1(Mus musculus (Mouse))
Ea Pharma
US Patent
Ea Pharma
US Patent
Affinity DataIC50: 0.620nMpH: 9.6 T: 2°CAssay Description:The ability of test substances to inhibit the binding of a human B cell line, RPMI-8866, which is known to express α4β7 integrin, to MAdCA...More data for this Ligand-Target Pair
TargetIntegrin alpha-4/Integrin beta-7/Mucosal addressin cell adhesion molecule 1(Mus musculus (Mouse))
Ea Pharma
US Patent
Ea Pharma
US Patent
Affinity DataIC50: 16nMpH: 9.6 T: 2°CAssay Description:The ability of test substances to inhibit the binding of a human B cell line, RPMI-8866, which is known to express α4β7 integrin, to MAdCA...More data for this Ligand-Target Pair
TargetIntegrin alpha-4/Integrin beta-1/Vascular cell adhesion protein 1(Homo sapiens (Human))
Ea Pharma
US Patent
Ea Pharma
US Patent
Affinity DataIC50: 160nMpH: 9.6 T: 2°CAssay Description:The ability of test substances to inhibit the binding of a human T-cell line, Jurkat, which is known to express α4β1 integrin, to VCAM-1 w...More data for this Ligand-Target Pair