BDBM362169 (S)-5-(5-chloro-2-(cyclopropyl((2,6-diamino-5-chloropyrimidin-4-yl)amino)methyl)-4-oxoquinazolin-3(4H)-yl)nicotinamide::US10221197, Compound 163::US10221197, Compound 164
SMILES NC(=O)c1cncc(c1)-n1c(nc2cccc(Cl)c2c1=O)[C@@H](Nc1nc(N)nc(N)c1C#N)C1CC1
InChI Key InChIKey=BVWKNRILWGEBCG-KRWDZBQOSA-N
Data 6 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 6 hits for monomerid = 362169
TargetPhosphatidylinositol 3-kinase regulatory subunit beta(Homo sapiens (Human))
Gilead Sciences
US Patent
Gilead Sciences
US Patent
Affinity DataIC50: 1.10E+4nMAssay Description:TR-FRET monitored the formation of 3,4,5-inositol triphosphate molecule that competed with fluorescently labeled PIP3 for binding to the GRP-1 plecks...More data for this Ligand-Target Pair
TargetPhosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit delta isoform(Homo sapiens (Human))
Gilead Sciences
US Patent
Gilead Sciences
US Patent
TargetPhosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform(Homo sapiens (Human))
Gilead Sciences
US Patent
Gilead Sciences
US Patent
TargetPhosphatidylinositol 3-kinase regulatory subunit beta(Homo sapiens (Human))
Gilead Sciences
US Patent
Gilead Sciences
US Patent
Affinity DataIC50: 2.00E+3nMAssay Description:TR-FRET monitored the formation of 3,4,5-inositol triphosphate molecule that competed with fluorescently labeled PIP3 for binding to the GRP-1 plecks...More data for this Ligand-Target Pair
TargetPhosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit delta isoform(Homo sapiens (Human))
Gilead Sciences
US Patent
Gilead Sciences
US Patent
TargetPhosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform(Homo sapiens (Human))
Gilead Sciences
US Patent
Gilead Sciences
US Patent