BDBM50076219 (3S,6R)-6-Amino-6-benzyl-octahydro-indolizine-3-carboxylic acid [(S)-1-(benzothiazole-2-carbonyl)-4-guanidino-butyl]-amide::CHEMBL27852
SMILES NC(=N)NCCC[C@H](NC(=O)[C@@H]1CCC2CC[C@@](N)(Cc3ccccc3)CN12)C(=O)c1nc2ccccc2s1
InChI Key InChIKey=MJPRZTFMWHJGMK-FFILHAAMSA-N
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 8 hits for monomerid = 50076219
Affinity DataKi: 0.230nMAssay Description:Inhibitory concentration of the compound against trypsin.More data for this Ligand-Target Pair
Affinity DataKi: 0.850nMAssay Description:Inhibitory concentration of the compound against thrombin.More data for this Ligand-Target Pair
Affinity DataKi: 0.850nMAssay Description:Inhibitory concentration of the compound against thrombin.More data for this Ligand-Target Pair
Affinity DataIC50: 200nMAssay Description:Inhibitory concentration of the compound against coagulation factor VIIaMore data for this Ligand-Target Pair
Affinity DataIC50: 335nMAssay Description:Inhibitory concentration of the compound against Urokinase-type plasminogen activatorMore data for this Ligand-Target Pair
Affinity DataIC50: 19.3nMAssay Description:Inhibitory concentration of the compound against Coagulation factor XaMore data for this Ligand-Target Pair
Affinity DataIC50: 251nMAssay Description:Inhibitory concentration of the compound against plasminMore data for this Ligand-Target Pair
Affinity DataIC50: 93nMAssay Description:Inhibitory concentration of the compound against Tissue type plasminogen activatorMore data for this Ligand-Target Pair