BDBM558411 US11365192, Example 45-42
SMILES OC(=O)c1nc2CN(Cc2o1)C(=O)c1cccc(COc2ccc(nc2)-c2ccn[nH]2)c1
InChI Key InChIKey=FBWRHTGPGDNJQF-UHFFFAOYSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 558411
Affinity DataIC50: 450nMAssay Description:In the CYP4F2 inhibition test, the reaction solution containing each compound [final concentration of 50 mM, KPO4 (pH 7.4), 2.5 μM luciferine de...More data for this Ligand-Target Pair
Affinity DataIC50: 34nMAssay Description:In the CYP4F2 inhibition test, the reaction solution containing each compound [final concentration of 50 mM, KPO4 (pH 7.4), 2.5 μM luciferine de...More data for this Ligand-Target Pair