BDBM50506263 CHEMBL4465054::US11401295, Compound 2',3'-cGAMP
SMILES [H][C@]12COP(O)(=O)O[C@@]3([H])[C@@H](O)[C@@H](O[C@]3([H])COP(O)(=O)O[C@@]([H])([C@@H](O1)n1cnc3c1nc(N)[nH]c3=O)[C@@H]2O)n1cnc2c(N)ncnc12
InChI Key InChIKey=XRILCFTWUCUKJR-INFSMZHSSA-N
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 1 hit for monomerid = 50506263
TargetStimulator of interferon genes protein [140-379](Homo sapiens (Human))
Shanghai Jemincare Pharmaceuticals
US Patent
Shanghai Jemincare Pharmaceuticals
US Patent
Affinity DataIC50: 6.66E+3nMAssay Description:Fluorescence polarization assay (FP assay) was used to detect the affinity of compounds for human STING proteins. There were a certain amount of fluo...More data for this Ligand-Target Pair