BDBM232943 US9351973, 13::US9844553, 13
SMILES CCc1c2NC(=O)CCn2nc1-c1cncc(F)c1
InChI Key InChIKey=NLBVRKTXFWFXOH-UHFFFAOYSA-N
Data 4 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 232943
Affinity DataIC50: 11.7nMT: 2°CAssay Description:V79 cell lines stably expressing the either the human CYP11B2 or the human CYP11B1 enzyme were generated using a standard transfection protocol. V79 ...More data for this Ligand-Target Pair
Affinity DataIC50: 1.35E+3nMT: 2°CAssay Description:V79 cell lines stably expressing the either the human CYP11B2 or the human CYP11B1 enzyme were generated using a standard transfection protocol. V79 ...More data for this Ligand-Target Pair