BDBM18860 (2R)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]propanoic acid::(2S)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]propanoic acid::3,5,3'-triiodo-L-thyronine (T3)::CHEMBL1544::Triiodothyronine::Triiodothyronine (T3)::US10544075, Compound T3::[125I]T3::liothyronine::triothyrone
SMILES N[C@@H](Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1)C(O)=O
InChI Key InChIKey=AUYYCJSJGJYCDS-LBPRGKRZSA-N
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 18860
Affinity DataIC50: 0.240nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRalpha. More data for this Ligand-Target Pair
Affinity DataIC50: 0.260nMpH: 7.0 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% binding of 125I-T3 to hTRbeta.More data for this Ligand-Target Pair