Details for Substrate BDBM21687 without Explicit Binding Affinity Data | |
| DNA polymerase alpha subunit B |
| DNA polymerase subunit gamma-1 |
| DNA polymerase III subunit alpha |
| DNA polymerase III PolC-type |
Synonyms: | ({[({[(2R,3S,5R)-5-(2-amino-6-oxo-6,9-dihydro-3H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy](hydroxy)phosphoryl}oxy)phosphonic acid | dGTP | deoxyguanosine triphosphate |
Type: | Nucleoside or nucleotide |
Emp. Form.: | C10H16N5O13P3 |
Mol. Mass.: | 507.181 g/mol |
SMILES: | Nc1nc2n(cnc2c(=O)[nH]1)[C@H]1C[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O1 |
Structure: |
Courtesy of Chemaxon Inc. - Use mouse to adjust image. - Double-click and use "Edit" menu to generate mol-file. |